C10H16O — CID 134856059
cis-(1R,3R)-1-ethynyl-2,2,3-trimethylcyclopentan-1-ol (PubChem CID 134856059) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is cis-(1R,3R)-1-ethynyl-2,2,3-trimethylcyclopentan-1-ol.
| Compound Name | cis-(1R,3R)-1-ethynyl-2,2,3-trimethylcyclopentan-1-ol |
|---|---|
| PubChem CID | 134856059 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | cis-(1R,3R)-1-ethynyl-2,2,3-trimethylcyclopentan-1-ol |
| SMILES | C#C[C@]1(O)CC[C@@H](C)C1(C)C |
| InChI | InChI=1S/C10H16O/c1-5-10(11)7-6-8(2)9(10,3)4/h1,8,11H,6-7H2,2-4H3/t8-,10+/m1/s1 |
| InChIKey | HVKUNJZWNWJGPD-SCZZXKLOSA-N |
| XLogP | 1.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|