C23H32O2 — CID 53463665
2,6-diethynyl-3a,5a,9-trimethyl-1,3,3b,4,5,7,8,8a,8b,9,10,10a-dodecahydroindeno[5,4-e]indene-2,6-diol (PubChem CID 53463665) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is 2,6-diethynyl-3a,5a,9-trimethyl-1,3,3b,4,5,7,8,8a,8b,9,10,10a-dodecahydroindeno[5,4-e]indene-2,6-diol.
| Compound Name | 2,6-diethynyl-3a,5a,9-trimethyl-1,3,3b,4,5,7,8,8a,8b,9,10,10a-dodecahydroindeno[5,4-e]indene-2,6-diol |
|---|---|
| PubChem CID | 53463665 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 2,6-diethynyl-3a,5a,9-trimethyl-1,3,3b,4,5,7,8,8a,8b,9,10,10a-dodecahydroindeno[5,4-e]indene-2,6-diol |
| SMILES | C#CC1(O)CC2CC(C)C3C(CCC4(C)C3CCC4(O)C#C)C2(C)C1 |
| InChI | InChI=1S/C23H32O2/c1-6-22(24)13-16-12-15(3)19-17(20(16,4)14-22)8-10-21(5)18(19)9-11-23(21,25)7-2/h1-2,15-19,24-25H,8-14H2,3-5H3 |
| InChIKey | IQVIPGMGOUKLCM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|