C10H18O2 — CID 134856008
1-[(1S,3R)-1-hydroxy-2,2,3-trimethylcyclopentyl]ethanone (PubChem CID 134856008) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 1-[(1S,3R)-1-hydroxy-2,2,3-trimethylcyclopentyl]ethanone.
| Compound Name | 1-[(1S,3R)-1-hydroxy-2,2,3-trimethylcyclopentyl]ethanone |
|---|---|
| PubChem CID | 134856008 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 1-[(1S,3R)-1-hydroxy-2,2,3-trimethylcyclopentyl]ethanone |
| SMILES | CC(=O)[C@]1(O)CC[C@@H](C)C1(C)C |
| InChI | InChI=1S/C10H18O2/c1-7-5-6-10(12,8(2)11)9(7,3)4/h7,12H,5-6H2,1-4H3/t7-,10-/m1/s1 |
| InChIKey | RBEAUWXONLGALC-GMSGAONNSA-N |
| XLogP | 1.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |