C11H17NO — CID 130030129
1,2,2,3-tetramethylcyclopentane-1-carbonyl cyanide (PubChem CID 130030129) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 1,2,2,3-tetramethylcyclopentane-1-carbonyl cyanide.
| Compound Name | 1,2,2,3-tetramethylcyclopentane-1-carbonyl cyanide |
|---|---|
| PubChem CID | 130030129 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1,2,2,3-tetramethylcyclopentane-1-carbonyl cyanide |
| SMILES | CC1CCC(C)(C(=O)C#N)C1(C)C |
| InChI | InChI=1S/C11H17NO/c1-8-5-6-11(4,9(13)7-12)10(8,2)3/h8H,5-6H2,1-4H3 |
| InChIKey | XQQHMIWLKGQNAN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|