C17H24O — CID 7054018
2-phenyl-1-[(1R,3S)-1,2,2,3-tetramethylcyclopentyl]ethanone (PubChem CID 7054018) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-phenyl-1-[(1R,3S)-1,2,2,3-tetramethylcyclopentyl]ethanone.
| Compound Name | 2-phenyl-1-[(1R,3S)-1,2,2,3-tetramethylcyclopentyl]ethanone |
|---|---|
| PubChem CID | 7054018 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 2-phenyl-1-[(1R,3S)-1,2,2,3-tetramethylcyclopentyl]ethanone |
| SMILES | C[C@H]1CC[C@@](C)(C(=O)Cc2ccccc2)C1(C)C |
| InChI | InChI=1S/C17H24O/c1-13-10-11-17(4,16(13,2)3)15(18)12-14-8-6-5-7-9-14/h5-9,13H,10-12H2,1-4H3/t13-,17-/m0/s1 |
| InChIKey | HIAZWIMMBMMADB-GUYCJALGSA-N |
| XLogP | 4.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |