C19H23NO3 — CID 7054264
2-[2-oxo-2-[(1R,3S)-1,2,2,3-tetramethylcyclopentyl]ethyl]isoindole-1,3-dione (PubChem CID 7054264) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-[2-oxo-2-[(1R,3S)-1,2,2,3-tetramethylcyclopentyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-oxo-2-[(1R,3S)-1,2,2,3-tetramethylcyclopentyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 7054264 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 2-[2-oxo-2-[(1R,3S)-1,2,2,3-tetramethylcyclopentyl]ethyl]isoindole-1,3-dione |
| SMILES | C[C@H]1CC[C@@](C)(C(=O)CN2C(=O)c3ccccc3C2=O)C1(C)C |
| InChI | InChI=1S/C19H23NO3/c1-12-9-10-19(4,18(12,2)3)15(21)11-20-16(22)13-7-5-6-8-14(13)17(20)23/h5-8,12H,9-11H2,1-4H3/t12-,19-/m0/s1 |
| InChIKey | SUWQWMJVXMAAJM-BUXKBTBVSA-N |
| XLogP | 3.31 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|