C16H20ClN3O3 — CID 120601411
2-(1,3-dioxoisoindol-2-yl)-N-(2-methylpiperidin-4-yl)acetamide;hydrochloride (PubChem CID 120601411) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(2-methylpiperidin-4-yl)acetamide;hydrochloride.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(2-methylpiperidin-4-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120601411 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(2-methylpiperidin-4-yl)acetamide;hydrochloride |
| SMILES | CC1CC(NC(=O)CN2C(=O)c3ccccc3C2=O)CCN1.Cl |
| InChI | InChI=1S/C16H19N3O3.ClH/c1-10-8-11(6-7-17-10)18-14(20)9-19-15(21)12-4-2-3-5-13(12)16(19)22;/h2-5,10-11,17H,6-9H2,1H3,(H,18,20);1H |
| InChIKey | ZPEQMNMIHYHVFW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|