C17H19N3O4 — CID 71930321
3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]cyclohexane-1-carboxamide (PubChem CID 71930321) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]cyclohexane-1-carboxamide.
| Compound Name | 3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 71930321 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCCC(NC(=O)CN2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C17H19N3O4/c18-15(22)10-4-3-5-11(8-10)19-14(21)9-20-16(23)12-6-1-2-7-13(12)17(20)24/h1-2,6-7,10-11H,3-5,8-9H2,(H2,18,22)(H,19,21) |
| InChIKey | NQVZGXBIFAGCLJ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|