C28H42O4 — CID 162882025
1-O-[[(1S,3S)-1,2,2,3-tetramethylcyclopentyl]methyl] 2-O-[[(1R,3R)-1,2,2,3-tetramethylcyclopentyl]methyl] benzene-1,2-dicarboxylate (PubChem CID 162882025) has the molecular formula C28H42O4 and a molecular weight of 442.64 g/mol. Its IUPAC name is 1-O-[[(1S,3S)-1,2,2,3-tetramethylcyclopentyl]methyl] 2-O-[[(1R,3R)-1,2,2,3-tetramethylcyclopentyl]methyl] benzene-1,2-dicarboxylate.
| Compound Name | 1-O-[[(1S,3S)-1,2,2,3-tetramethylcyclopentyl]methyl] 2-O-[[(1R,3R)-1,2,2,3-tetramethylcyclopentyl]methyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 162882025 |
| Molecular Formula | C28H42O4 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | 1-O-[[(1S,3S)-1,2,2,3-tetramethylcyclopentyl]methyl] 2-O-[[(1R,3R)-1,2,2,3-tetramethylcyclopentyl]methyl] benzene-1,2-dicarboxylate |
| SMILES | C[C@@H]1CC[C@@](C)(COC(=O)c2ccccc2C(=O)OC[C@@]2(C)CC[C@H](C)C2(C)C)C1(C)C |
| InChI | InChI=1S/C28H42O4/c1-19-13-15-27(7,25(19,3)4)17-31-23(29)21-11-9-10-12-22(21)24(30)32-18-28(8)16-14-20(2)26(28,5)6/h9-12,19-20H,13-18H2,1-8H3/t19-,20+,27+,28- |
| InChIKey | NKAAAQIOGVGJLI-YTIACTDOSA-N |
| XLogP | 6.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |