C21H34O3 — CID 98102575
[(1S,3S)-1,2,2,3-tetramethylcyclopentyl]methyl (1S,2R,4R)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 98102575) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is [(1S,3S)-1,2,2,3-tetramethylcyclopentyl]methyl (1S,2R,4R)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | [(1S,3S)-1,2,2,3-tetramethylcyclopentyl]methyl (1S,2R,4R)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 98102575 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | [(1S,3S)-1,2,2,3-tetramethylcyclopentyl]methyl (1S,2R,4R)-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | C[C@H]1CC[C@](C)(COC(=O)[C@H]2C(=O)[C@]3(C)CC[C@@H]2C3(C)C)C1(C)C |
| InChI | InChI=1S/C21H34O3/c1-13-8-10-20(6,18(13,2)3)12-24-17(23)15-14-9-11-21(7,16(15)22)19(14,4)5/h13-15H,8-12H2,1-7H3/t13-,14-,15+,20+,21-/m0/s1 |
| InChIKey | HCERMHIQIKFMFV-SPYXRDKXSA-N |
| XLogP | 4.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|