C38H50O4 — CID 118707515
bis[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl] benzene-1,2-dicarboxylate (PubChem CID 118707515) has the molecular formula C38H50O4 and a molecular weight of 570.81 g/mol. Its IUPAC name is bis[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl] benzene-1,2-dicarboxylate.
| Compound Name | bis[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 118707515 |
| Molecular Formula | C38H50O4 |
| Molecular Weight | 570.81 g/mol |
| Exact Mass | 570.37 |
| IUPAC Name | bis[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl] benzene-1,2-dicarboxylate |
| SMILES | C=C[C@]1(C)CC[C@@H](C(=C)COC(=O)c2ccccc2C(=O)OCC(=C)[C@@H]2CC[C@@](C)(C=C)[C@H](C(=C)C)C2)C[C@H]1C(=C)C |
| InChI | InChI=1S/C38H50O4/c1-11-37(9)19-17-29(21-33(37)25(3)4)27(7)23-41-35(39)31-15-13-14-16-32(31)36(40)42-24-28(8)30-18-20-38(10,12-2)34(22-30)26(5)6/h11-16,29-30,33-34H,1-3,5,7-8,17-24H2,4,6,9-10H3/t29-,30-,33+,34+,37-,38-/m1/s1 |
| InChIKey | GWBPBEZOLRLLGT-HPRYOGBXSA-N |
| XLogP | 9.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.81 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|