C18H30O2 — CID 44571138
(1S,2S,4R)-1-ethenyl-4-[3-(2-methoxyethoxy)prop-1-en-2-yl]-1-methyl-2-prop-1-en-2-ylcyclohexane (PubChem CID 44571138) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (1S,2S,4R)-1-ethenyl-4-[3-(2-methoxyethoxy)prop-1-en-2-yl]-1-methyl-2-prop-1-en-2-ylcyclohexane.
| Compound Name | (1S,2S,4R)-1-ethenyl-4-[3-(2-methoxyethoxy)prop-1-en-2-yl]-1-methyl-2-prop-1-en-2-ylcyclohexane |
|---|---|
| PubChem CID | 44571138 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (1S,2S,4R)-1-ethenyl-4-[3-(2-methoxyethoxy)prop-1-en-2-yl]-1-methyl-2-prop-1-en-2-ylcyclohexane |
| SMILES | C=C[C@]1(C)CC[C@@H](C(=C)COCCOC)C[C@H]1C(=C)C |
| InChI | InChI=1S/C18H30O2/c1-7-18(5)9-8-16(12-17(18)14(2)3)15(4)13-20-11-10-19-6/h7,16-17H,1-2,4,8-13H2,3,5-6H3/t16-,17+,18-/m1/s1 |
| InChIKey | NIIRVXYEONYOAO-FGTMMUONSA-N |
| XLogP | 4.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|