C48H51ClO3 — CID 170222012
2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl 4-[(1E)-4-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]penta-1,4-dienyl]benzoate (PubChem CID 170222012) has the molecular formula C48H51ClO3 and a molecular weight of 711.39 g/mol. Its IUPAC name is 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl 4-[(1E)-4-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]penta-1,4-dienyl]benzoate.
| Compound Name | 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl 4-[(1E)-4-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]penta-1,4-dienyl]benzoate |
|---|---|
| PubChem CID | 170222012 |
| Molecular Formula | C48H51ClO3 |
| Molecular Weight | 711.39 g/mol |
| Exact Mass | 710.35 |
| IUPAC Name | 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl 4-[(1E)-4-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]penta-1,4-dienyl]benzoate |
| SMILES | C=C[C@]1(C)CC[C@@H](C(=C)C/C=C/c2ccc(C(=O)OCCOc3ccc(/C(=C(/CCCl)c4ccccc4)c4ccccc4)cc3)cc2)C[C@H]1C(=C)C |
| InChI | InChI=1S/C48H51ClO3/c1-6-48(5)30-28-42(34-45(48)35(2)3)36(4)14-13-15-37-20-22-41(23-21-37)47(50)52-33-32-51-43-26-24-40(25-27-43)46(39-18-11-8-12-19-39)44(29-31-49)38-16-9-7-10-17-38/h6-13,15-27,42,45H,1-2,4,14,28-34H2,3,5H3/b15-13+,46-44-/t42-,45+,48-/m1/s1 |
| InChIKey | ZSJYEXXKYUHZON-OLLUGITHSA-N |
| XLogP | 12.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.39 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|