C30H34BClO3 — CID 164671924
2-[2-[4-[(E)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 164671924) has the molecular formula C30H34BClO3 and a molecular weight of 488.86 g/mol. Its IUPAC name is 2-[2-[4-[(E)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-[4-[(E)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 164671924 |
| Molecular Formula | C30H34BClO3 |
| Molecular Weight | 488.86 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 2-[2-[4-[(E)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(CCOc2ccc(/C(=C(\CCCl)c3ccccc3)c3ccccc3)cc2)OC1(C)C |
| InChI | InChI=1S/C30H34BClO3/c1-29(2)30(3,4)35-31(34-29)20-22-33-26-17-15-25(16-18-26)28(24-13-9-6-10-14-24)27(19-21-32)23-11-7-5-8-12-23/h5-18H,19-22H2,1-4H3/b28-27+ |
| InChIKey | GOFLEDJXGAFGKM-BYYHNAKLSA-N |
| XLogP | 7.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.86 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|