C49H50Cl2O4 — CID 161238047
4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenol;2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethanol;propan-1-ol (PubChem CID 161238047) has the molecular formula C49H50Cl2O4 and a molecular weight of 773.84 g/mol. Its IUPAC name is 4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenol;2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethanol;propan-1-ol.
| Compound Name | 4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenol;2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethanol;propan-1-ol |
|---|---|
| PubChem CID | 161238047 |
| Molecular Formula | C49H50Cl2O4 |
| Molecular Weight | 773.84 g/mol |
| Exact Mass | 772.31 |
| IUPAC Name | 4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenol;2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethanol;propan-1-ol |
| SMILES | CCCO.OCCOc1ccc(/C(=C(/CCCl)c2ccccc2)c2ccccc2)cc1.Oc1ccc(/C(=C(/CCCl)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23ClO2.C22H19ClO.C3H8O/c25-16-15-23(19-7-3-1-4-8-19)24(20-9-5-2-6-10-20)21-11-13-22(14-12-21)27-18-17-26;23-16-15-21(17-7-3-1-4-8-17)22(18-9-5-2-6-10-18)19-11-13-20(24)14-12-19;1-2-3-4/h1-14,26H,15-18H2;1-14,24H,15-16H2;4H,2-3H2,1H3/b24-23-;22-21-; |
| InChIKey | UZQBSIYIBPBLDQ-OVVPMWNOSA-N |
| XLogP | 12.01 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.84 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|