C25H26O4 — CID 16739990
4-[2-[3-(2-hydroxyethoxy)phenyl]-1-(4-hydroxyphenyl)pent-1-enyl]phenol (PubChem CID 16739990) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is 4-[2-[3-(2-hydroxyethoxy)phenyl]-1-(4-hydroxyphenyl)pent-1-enyl]phenol.
| Compound Name | 4-[2-[3-(2-hydroxyethoxy)phenyl]-1-(4-hydroxyphenyl)pent-1-enyl]phenol |
|---|---|
| PubChem CID | 16739990 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 4-[2-[3-(2-hydroxyethoxy)phenyl]-1-(4-hydroxyphenyl)pent-1-enyl]phenol |
| SMILES | CCCC(=C(c1ccc(O)cc1)c1ccc(O)cc1)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C25H26O4/c1-2-4-24(20-5-3-6-23(17-20)29-16-15-26)25(18-7-11-21(27)12-8-18)19-9-13-22(28)14-10-19/h3,5-14,17,26-28H,2,4,15-16H2,1H3 |
| InChIKey | XWXTZNWOJCNEMK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|