C28H32O5 — CID 16740081
4-[2-[3-[2-(2-hydroxyethoxy)ethyl]-4-methoxyphenyl]-1-(4-hydroxyphenyl)pent-1-enyl]phenol (PubChem CID 16740081) has the molecular formula C28H32O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is 4-[2-[3-[2-(2-hydroxyethoxy)ethyl]-4-methoxyphenyl]-1-(4-hydroxyphenyl)pent-1-enyl]phenol.
| Compound Name | 4-[2-[3-[2-(2-hydroxyethoxy)ethyl]-4-methoxyphenyl]-1-(4-hydroxyphenyl)pent-1-enyl]phenol |
|---|---|
| PubChem CID | 16740081 |
| Molecular Formula | C28H32O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 4-[2-[3-[2-(2-hydroxyethoxy)ethyl]-4-methoxyphenyl]-1-(4-hydroxyphenyl)pent-1-enyl]phenol |
| SMILES | CCCC(=C(c1ccc(O)cc1)c1ccc(O)cc1)c1ccc(OC)c(CCOCCO)c1 |
| InChI | InChI=1S/C28H32O5/c1-3-4-26(22-9-14-27(32-2)23(19-22)15-17-33-18-16-29)28(20-5-10-24(30)11-6-20)21-7-12-25(31)13-8-21/h5-14,19,29-31H,3-4,15-18H2,1-2H3 |
| InChIKey | GJJKTEMMWDRGJA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|