C27H28O6 — CID 59869376
2-[4-[1,1-bis(4-hydroxyphenyl)hex-1-en-2-yl]-2-methoxyphenoxy]acetic acid (PubChem CID 59869376) has the molecular formula C27H28O6 and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-[4-[1,1-bis(4-hydroxyphenyl)hex-1-en-2-yl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[1,1-bis(4-hydroxyphenyl)hex-1-en-2-yl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 59869376 |
| Molecular Formula | C27H28O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 2-[4-[1,1-bis(4-hydroxyphenyl)hex-1-en-2-yl]-2-methoxyphenoxy]acetic acid |
| SMILES | CCCCC(=C(c1ccc(O)cc1)c1ccc(O)cc1)c1ccc(OCC(=O)O)c(OC)c1 |
| InChI | InChI=1S/C27H28O6/c1-3-4-5-23(20-10-15-24(25(16-20)32-2)33-17-26(30)31)27(18-6-11-21(28)12-7-18)19-8-13-22(29)14-9-19/h6-16,28-29H,3-5,17H2,1-2H3,(H,30,31) |
| InChIKey | VKUGTQNAVIFGJE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|