C26H28O5 — CID 16744280
4-[2-[4-(2-hydroxyethoxy)-3-methoxyphenyl]-1-(4-hydroxyphenyl)pent-1-enyl]phenol (PubChem CID 16744280) has the molecular formula C26H28O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is 4-[2-[4-(2-hydroxyethoxy)-3-methoxyphenyl]-1-(4-hydroxyphenyl)pent-1-enyl]phenol.
| Compound Name | 4-[2-[4-(2-hydroxyethoxy)-3-methoxyphenyl]-1-(4-hydroxyphenyl)pent-1-enyl]phenol |
|---|---|
| PubChem CID | 16744280 |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 4-[2-[4-(2-hydroxyethoxy)-3-methoxyphenyl]-1-(4-hydroxyphenyl)pent-1-enyl]phenol |
| SMILES | CCCC(=C(c1ccc(O)cc1)c1ccc(O)cc1)c1ccc(OCCO)c(OC)c1 |
| InChI | InChI=1S/C26H28O5/c1-3-4-23(20-9-14-24(31-16-15-27)25(17-20)30-2)26(18-5-10-21(28)11-6-18)19-7-12-22(29)13-8-19/h5-14,17,27-29H,3-4,15-16H2,1-2H3 |
| InChIKey | MHVZMHLKZDLGTQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|