C27H26O5 — CID 69135719
3-[5-[1,1-bis(4-hydroxyphenyl)pent-1-en-2-yl]-2-methoxyphenyl]prop-2-enoic acid (PubChem CID 69135719) has the molecular formula C27H26O5 and a molecular weight of 430.50 g/mol. Its IUPAC name is 3-[5-[1,1-bis(4-hydroxyphenyl)pent-1-en-2-yl]-2-methoxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[5-[1,1-bis(4-hydroxyphenyl)pent-1-en-2-yl]-2-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69135719 |
| Molecular Formula | C27H26O5 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 3-[5-[1,1-bis(4-hydroxyphenyl)pent-1-en-2-yl]-2-methoxyphenyl]prop-2-enoic acid |
| SMILES | CCCC(=C(c1ccc(O)cc1)c1ccc(O)cc1)c1ccc(OC)c(C=CC(=O)O)c1 |
| InChI | InChI=1S/C27H26O5/c1-3-4-24(20-9-15-25(32-2)21(17-20)10-16-26(30)31)27(18-5-11-22(28)12-6-18)19-7-13-23(29)14-8-19/h5-17,28-29H,3-4H2,1-2H3,(H,30,31) |
| InChIKey | RMPHHOFJNIXSHM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|