C19H18O5 — CID 51036573
(1E,4E)-1,5-bis(5-hydroxy-2-methoxyphenyl)penta-1,4-dien-3-one (PubChem CID 51036573) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is (1E,4E)-1,5-bis(5-hydroxy-2-methoxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis(5-hydroxy-2-methoxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 51036573 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (1E,4E)-1,5-bis(5-hydroxy-2-methoxyphenyl)penta-1,4-dien-3-one |
| SMILES | COc1ccc(O)cc1/C=C/C(=O)/C=C/c1cc(O)ccc1OC |
| InChI | InChI=1S/C19H18O5/c1-23-18-9-7-16(21)11-13(18)3-5-15(20)6-4-14-12-17(22)8-10-19(14)24-2/h3-12,21-22H,1-2H3/b5-3+,6-4+ |
| InChIKey | KTYWGQJOAXQBNU-GGWOSOGESA-N |
| XLogP | 3.41 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|