C14H13ClO3 — CID 170468623
(E)-3-[5-(4-chlorobut-1-ynyl)-2-methoxyphenyl]prop-2-enoic acid (PubChem CID 170468623) has the molecular formula C14H13ClO3 and a molecular weight of 264.71 g/mol. Its IUPAC name is (E)-3-[5-(4-chlorobut-1-ynyl)-2-methoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(4-chlorobut-1-ynyl)-2-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170468623 |
| Molecular Formula | C14H13ClO3 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | (E)-3-[5-(4-chlorobut-1-ynyl)-2-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1ccc(C#CCCCl)cc1/C=C/C(=O)O |
| InChI | InChI=1S/C14H13ClO3/c1-18-13-7-5-11(4-2-3-9-15)10-12(13)6-8-14(16)17/h5-8,10H,3,9H2,1H3,(H,16,17)/b8-6+ |
| InChIKey | LGQXMXHBNAVAPB-SOFGYWHQSA-N |
| XLogP | 2.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|