C13H13ClO3 — CID 170468567
2-[3-(4-chlorobut-1-ynyl)-4-methoxyphenyl]acetic acid (PubChem CID 170468567) has the molecular formula C13H13ClO3 and a molecular weight of 252.70 g/mol. Its IUPAC name is 2-[3-(4-chlorobut-1-ynyl)-4-methoxyphenyl]acetic acid.
| Compound Name | 2-[3-(4-chlorobut-1-ynyl)-4-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 170468567 |
| Molecular Formula | C13H13ClO3 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 2-[3-(4-chlorobut-1-ynyl)-4-methoxyphenyl]acetic acid |
| SMILES | COc1ccc(CC(=O)O)cc1C#CCCCl |
| InChI | InChI=1S/C13H13ClO3/c1-17-12-6-5-10(9-13(15)16)8-11(12)4-2-3-7-14/h5-6,8H,3,7,9H2,1H3,(H,15,16) |
| InChIKey | QPJOFBQVACAQQM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|