C12H15ClO5 — CID 171862925
2-[3-(3-chloro-1,2-dihydroxypropyl)-4-methoxyphenyl]acetic acid (PubChem CID 171862925) has the molecular formula C12H15ClO5 and a molecular weight of 274.70 g/mol. Its IUPAC name is 2-[3-(3-chloro-1,2-dihydroxypropyl)-4-methoxyphenyl]acetic acid.
| Compound Name | 2-[3-(3-chloro-1,2-dihydroxypropyl)-4-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 171862925 |
| Molecular Formula | C12H15ClO5 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-[3-(3-chloro-1,2-dihydroxypropyl)-4-methoxyphenyl]acetic acid |
| SMILES | COc1ccc(CC(=O)O)cc1C(O)C(O)CCl |
| InChI | InChI=1S/C12H15ClO5/c1-18-10-3-2-7(5-11(15)16)4-8(10)12(17)9(14)6-13/h2-4,9,12,14,17H,5-6H2,1H3,(H,15,16) |
| InChIKey | UYRRQOLODMUHNP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|