C12H16O6 — CID 170818730
2-[4-methoxy-3-(1,2,3-trihydroxypropyl)phenyl]acetic acid (PubChem CID 170818730) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is 2-[4-methoxy-3-(1,2,3-trihydroxypropyl)phenyl]acetic acid.
| Compound Name | 2-[4-methoxy-3-(1,2,3-trihydroxypropyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 170818730 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-[4-methoxy-3-(1,2,3-trihydroxypropyl)phenyl]acetic acid |
| SMILES | COc1ccc(CC(=O)O)cc1C(O)C(O)CO |
| InChI | InChI=1S/C12H16O6/c1-18-10-3-2-7(5-11(15)16)4-8(10)12(17)9(14)6-13/h2-4,9,12-14,17H,5-6H2,1H3,(H,15,16) |
| InChIKey | FIBYKUMIRIENDY-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |