C13H16O7 — CID 171878567
4-[5-(carboxymethyl)-2-methoxyphenyl]-3,4-dihydroxybutanoic acid (PubChem CID 171878567) has the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. Its IUPAC name is 4-[5-(carboxymethyl)-2-methoxyphenyl]-3,4-dihydroxybutanoic acid.
| Compound Name | 4-[5-(carboxymethyl)-2-methoxyphenyl]-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171878567 |
| Molecular Formula | C13H16O7 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 4-[5-(carboxymethyl)-2-methoxyphenyl]-3,4-dihydroxybutanoic acid |
| SMILES | COc1ccc(CC(=O)O)cc1C(O)C(O)CC(=O)O |
| InChI | InChI=1S/C13H16O7/c1-20-10-3-2-7(5-11(15)16)4-8(10)13(19)9(14)6-12(17)18/h2-4,9,13-14,19H,5-6H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | XHSMALSFYMWBDT-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |