C13H13ClO3 — CID 170468560
2-(4-chlorobut-1-ynyl)-4,5-dimethoxybenzaldehyde (PubChem CID 170468560) has the molecular formula C13H13ClO3 and a molecular weight of 252.70 g/mol. Its IUPAC name is 2-(4-chlorobut-1-ynyl)-4,5-dimethoxybenzaldehyde.
| Compound Name | 2-(4-chlorobut-1-ynyl)-4,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 170468560 |
| Molecular Formula | C13H13ClO3 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 2-(4-chlorobut-1-ynyl)-4,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(C#CCCCl)c(C=O)cc1OC |
| InChI | InChI=1S/C13H13ClO3/c1-16-12-7-10(5-3-4-6-14)11(9-15)8-13(12)17-2/h7-9H,4,6H2,1-2H3 |
| InChIKey | KWAIFSLPJFOCNA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|