C14H17NO3 — CID 170465172
2,5-dimethoxy-4-[4-(methylamino)but-1-ynyl]benzaldehyde (PubChem CID 170465172) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 2,5-dimethoxy-4-[4-(methylamino)but-1-ynyl]benzaldehyde.
| Compound Name | 2,5-dimethoxy-4-[4-(methylamino)but-1-ynyl]benzaldehyde |
|---|---|
| PubChem CID | 170465172 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2,5-dimethoxy-4-[4-(methylamino)but-1-ynyl]benzaldehyde |
| SMILES | CNCCC#Cc1cc(OC)c(C=O)cc1OC |
| InChI | InChI=1S/C14H17NO3/c1-15-7-5-4-6-11-8-14(18-3)12(10-16)9-13(11)17-2/h8-10,15H,5,7H2,1-3H3 |
| InChIKey | SKSXJDOHCAIKDM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|