C16H16Br2O2 — CID 170457270
1,2-bis(4-bromobut-1-ynyl)-4,5-dimethoxybenzene (PubChem CID 170457270) has the molecular formula C16H16Br2O2 and a molecular weight of 400.11 g/mol. Its IUPAC name is 1,2-bis(4-bromobut-1-ynyl)-4,5-dimethoxybenzene.
| Compound Name | 1,2-bis(4-bromobut-1-ynyl)-4,5-dimethoxybenzene |
|---|---|
| PubChem CID | 170457270 |
| Molecular Formula | C16H16Br2O2 |
| Molecular Weight | 400.11 g/mol |
| Exact Mass | 397.95 |
| IUPAC Name | 1,2-bis(4-bromobut-1-ynyl)-4,5-dimethoxybenzene |
| SMILES | COc1cc(C#CCCBr)c(C#CCCBr)cc1OC |
| InChI | InChI=1S/C16H16Br2O2/c1-19-15-11-13(7-3-5-9-17)14(8-4-6-10-18)12-16(15)20-2/h11-12H,5-6,9-10H2,1-2H3 |
| InChIKey | DPDOWHINLOHINA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.11 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|