C25H21ClO4 — CID 68799297
3-[4-[4-chloro-1,1-bis(4-hydroxyphenyl)but-1-en-2-yl]phenyl]prop-2-enoic acid (PubChem CID 68799297) has the molecular formula C25H21ClO4 and a molecular weight of 420.89 g/mol. Its IUPAC name is 3-[4-[4-chloro-1,1-bis(4-hydroxyphenyl)but-1-en-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[4-chloro-1,1-bis(4-hydroxyphenyl)but-1-en-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68799297 |
| Molecular Formula | C25H21ClO4 |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 3-[4-[4-chloro-1,1-bis(4-hydroxyphenyl)but-1-en-2-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(C(CCCl)=C(c2ccc(O)cc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C25H21ClO4/c26-16-15-23(18-4-1-17(2-5-18)3-14-24(29)30)25(19-6-10-21(27)11-7-19)20-8-12-22(28)13-9-20/h1-14,27-28H,15-16H2,(H,29,30) |
| InChIKey | KLCLZNQCLFVUPD-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|