C29H29ClO3 — CID 90768486
tert-butyl 3-[4-[4-chloro-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoate (PubChem CID 90768486) has the molecular formula C29H29ClO3 and a molecular weight of 461.00 g/mol. Its IUPAC name is tert-butyl 3-[4-[4-chloro-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoate.
| Compound Name | tert-butyl 3-[4-[4-chloro-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 90768486 |
| Molecular Formula | C29H29ClO3 |
| Molecular Weight | 461.00 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | tert-butyl 3-[4-[4-chloro-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)C=Cc1ccc(C(=C(CCCl)c2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C29H29ClO3/c1-29(2,3)33-27(32)18-11-21-9-12-23(13-10-21)28(24-14-16-25(31)17-15-24)26(19-20-30)22-7-5-4-6-8-22/h4-18,31H,19-20H2,1-3H3 |
| InChIKey | FWGCQZPBQJSFSR-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.00 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|