C27H32O3 — CID 68977222
tert-butyl (E)-3-[4-[cycloheptylidene-(4-hydroxyphenyl)methyl]phenyl]prop-2-enoate (PubChem CID 68977222) has the molecular formula C27H32O3 and a molecular weight of 404.55 g/mol. Its IUPAC name is tert-butyl (E)-3-[4-[cycloheptylidene-(4-hydroxyphenyl)methyl]phenyl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[4-[cycloheptylidene-(4-hydroxyphenyl)methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 68977222 |
| Molecular Formula | C27H32O3 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | tert-butyl (E)-3-[4-[cycloheptylidene-(4-hydroxyphenyl)methyl]phenyl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/c1ccc(C(=C2CCCCCC2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C27H32O3/c1-27(2,3)30-25(29)19-12-20-10-13-22(14-11-20)26(21-8-6-4-5-7-9-21)23-15-17-24(28)18-16-23/h10-19,28H,4-9H2,1-3H3/b19-12+ |
| InChIKey | BRVFDZFIHAJURA-XDHOZWIPSA-N |
| XLogP | 6.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|