C29H33NO4 — CID 68654594
1-[3-[4-[cycloheptylidene-(4-hydroxyphenyl)methyl]phenyl]prop-2-enoyl]piperidine-3-carboxylic acid (PubChem CID 68654594) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is 1-[3-[4-[cycloheptylidene-(4-hydroxyphenyl)methyl]phenyl]prop-2-enoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[3-[4-[cycloheptylidene-(4-hydroxyphenyl)methyl]phenyl]prop-2-enoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 68654594 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 1-[3-[4-[cycloheptylidene-(4-hydroxyphenyl)methyl]phenyl]prop-2-enoyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(=O)C=Cc2ccc(C(=C3CCCCCC3)c3ccc(O)cc3)cc2)C1 |
| InChI | InChI=1S/C29H33NO4/c31-26-16-14-24(15-17-26)28(22-6-3-1-2-4-7-22)23-12-9-21(10-13-23)11-18-27(32)30-19-5-8-25(20-30)29(33)34/h9-18,25,31H,1-8,19-20H2,(H,33,34) |
| InChIKey | LHUATOCBPYWODS-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|