C26H30O3 — CID 68978699
ethyl 3-[4-[cyclohexylidene-(4-hydroxy-2,3-dimethylphenyl)methyl]phenyl]prop-2-enoate (PubChem CID 68978699) has the molecular formula C26H30O3 and a molecular weight of 390.52 g/mol. Its IUPAC name is ethyl 3-[4-[cyclohexylidene-(4-hydroxy-2,3-dimethylphenyl)methyl]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-[cyclohexylidene-(4-hydroxy-2,3-dimethylphenyl)methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 68978699 |
| Molecular Formula | C26H30O3 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | ethyl 3-[4-[cyclohexylidene-(4-hydroxy-2,3-dimethylphenyl)methyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(C(=C2CCCCC2)c2ccc(O)c(C)c2C)cc1 |
| InChI | InChI=1S/C26H30O3/c1-4-29-25(28)17-12-20-10-13-22(14-11-20)26(21-8-6-5-7-9-21)23-15-16-24(27)19(3)18(23)2/h10-17,27H,4-9H2,1-3H3 |
| InChIKey | RWBIHHUAPIDZMK-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|