C22H21FO3 — CID 68654367
3-[4-[cyclohexylidene-(3-fluoro-4-hydroxyphenyl)methyl]phenyl]prop-2-enoic acid (PubChem CID 68654367) has the molecular formula C22H21FO3 and a molecular weight of 352.41 g/mol. Its IUPAC name is 3-[4-[cyclohexylidene-(3-fluoro-4-hydroxyphenyl)methyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[cyclohexylidene-(3-fluoro-4-hydroxyphenyl)methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68654367 |
| Molecular Formula | C22H21FO3 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 3-[4-[cyclohexylidene-(3-fluoro-4-hydroxyphenyl)methyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(C(=C2CCCCC2)c2ccc(O)c(F)c2)cc1 |
| InChI | InChI=1S/C22H21FO3/c23-19-14-18(11-12-20(19)24)22(16-4-2-1-3-5-16)17-9-6-15(7-10-17)8-13-21(25)26/h6-14,24H,1-5H2,(H,25,26) |
| InChIKey | MUSXRSKAGXTKQI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|