C28H33ClO3 — CID 68976427
ethyl 3-[4-[(3-chloro-4-hydroxyphenyl)-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenyl]prop-2-enoate (PubChem CID 68976427) has the molecular formula C28H33ClO3 and a molecular weight of 453.02 g/mol. Its IUPAC name is ethyl 3-[4-[(3-chloro-4-hydroxyphenyl)-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-[(3-chloro-4-hydroxyphenyl)-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 68976427 |
| Molecular Formula | C28H33ClO3 |
| Molecular Weight | 453.02 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | ethyl 3-[4-[(3-chloro-4-hydroxyphenyl)-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(C(=C2CC(C)(C)CC(C)(C)C2)c2ccc(O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C28H33ClO3/c1-6-32-25(31)14-9-19-7-10-20(11-8-19)26(21-12-13-24(30)23(29)15-21)22-16-27(2,3)18-28(4,5)17-22/h7-15,30H,6,16-18H2,1-5H3 |
| InChIKey | DEHOCQPZNWKOLE-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.02 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|