C29H29ClO4 — CID 123937919
[4-[4-chloro-1-[4-(2-oxoethoxy)phenyl]-2-phenylbut-1-enyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 123937919) has the molecular formula C29H29ClO4 and a molecular weight of 477.00 g/mol. Its IUPAC name is [4-[4-chloro-1-[4-(2-oxoethoxy)phenyl]-2-phenylbut-1-enyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[4-chloro-1-[4-(2-oxoethoxy)phenyl]-2-phenylbut-1-enyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 123937919 |
| Molecular Formula | C29H29ClO4 |
| Molecular Weight | 477.00 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | [4-[4-chloro-1-[4-(2-oxoethoxy)phenyl]-2-phenylbut-1-enyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc(C(=C(CCCl)c2ccccc2)c2ccc(OCC=O)cc2)cc1 |
| InChI | InChI=1S/C29H29ClO4/c1-29(2,3)28(32)34-25-15-11-23(12-16-25)27(22-9-13-24(14-10-22)33-20-19-31)26(17-18-30)21-7-5-4-6-8-21/h4-16,19H,17-18,20H2,1-3H3 |
| InChIKey | XREBECNOUXWSSI-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.00 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|