C29H31ClO3 — CID 11397095
[4-[(Z)-5-chloro-1-(4-hydroxyphenyl)-2-phenylpent-1-enyl]phenyl] 3,3-dimethylbutanoate (PubChem CID 11397095) has the molecular formula C29H31ClO3 and a molecular weight of 463.02 g/mol. Its IUPAC name is [4-[(Z)-5-chloro-1-(4-hydroxyphenyl)-2-phenylpent-1-enyl]phenyl] 3,3-dimethylbutanoate.
| Compound Name | [4-[(Z)-5-chloro-1-(4-hydroxyphenyl)-2-phenylpent-1-enyl]phenyl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 11397095 |
| Molecular Formula | C29H31ClO3 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | [4-[(Z)-5-chloro-1-(4-hydroxyphenyl)-2-phenylpent-1-enyl]phenyl] 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)Oc1ccc(/C(=C(/CCCCl)c2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C29H31ClO3/c1-29(2,3)20-27(32)33-25-17-13-23(14-18-25)28(22-11-15-24(31)16-12-22)26(10-7-19-30)21-8-5-4-6-9-21/h4-6,8-9,11-18,31H,7,10,19-20H2,1-3H3/b28-26- |
| InChIKey | BTIWJLHJUUVVSB-SGEDCAFJSA-N |
| XLogP | 7.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|