C32H30O4 — CID 158903679
phenyl (Z)-6-[4-(2-hydroxyethoxy)phenyl]-5,6-diphenylhex-5-enoate (PubChem CID 158903679) has the molecular formula C32H30O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is phenyl (Z)-6-[4-(2-hydroxyethoxy)phenyl]-5,6-diphenylhex-5-enoate.
| Compound Name | phenyl (Z)-6-[4-(2-hydroxyethoxy)phenyl]-5,6-diphenylhex-5-enoate |
|---|---|
| PubChem CID | 158903679 |
| Molecular Formula | C32H30O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | phenyl (Z)-6-[4-(2-hydroxyethoxy)phenyl]-5,6-diphenylhex-5-enoate |
| SMILES | O=C(CCC/C(=C(\c1ccccc1)c1ccc(OCCO)cc1)c1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C32H30O4/c33-23-24-35-28-21-19-27(20-22-28)32(26-13-6-2-7-14-26)30(25-11-4-1-5-12-25)17-10-18-31(34)36-29-15-8-3-9-16-29/h1-9,11-16,19-22,33H,10,17-18,23-24H2/b32-30- |
| InChIKey | NWXUHMPHECJQHU-GCUVURNUSA-N |
| XLogP | 6.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|