C28H27ClO3 — CID 89186517
[4-[(Z)-5-chloro-1-(4-hydroxyphenyl)-2-phenylpent-1-enyl]phenyl] 3-methylbut-3-enoate (PubChem CID 89186517) has the molecular formula C28H27ClO3 and a molecular weight of 446.97 g/mol. Its IUPAC name is [4-[(Z)-5-chloro-1-(4-hydroxyphenyl)-2-phenylpent-1-enyl]phenyl] 3-methylbut-3-enoate.
| Compound Name | [4-[(Z)-5-chloro-1-(4-hydroxyphenyl)-2-phenylpent-1-enyl]phenyl] 3-methylbut-3-enoate |
|---|---|
| PubChem CID | 89186517 |
| Molecular Formula | C28H27ClO3 |
| Molecular Weight | 446.97 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | [4-[(Z)-5-chloro-1-(4-hydroxyphenyl)-2-phenylpent-1-enyl]phenyl] 3-methylbut-3-enoate |
| SMILES | C=C(C)CC(=O)Oc1ccc(/C(=C(/CCCCl)c2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C28H27ClO3/c1-20(2)19-27(31)32-25-16-12-23(13-17-25)28(22-10-14-24(30)15-11-22)26(9-6-18-29)21-7-4-3-5-8-21/h3-5,7-8,10-17,30H,1,6,9,18-19H2,2H3/b28-26- |
| InChIKey | KGLBRLWXYPAZPF-SGEDCAFJSA-N |
| XLogP | 7.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.97 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|