C27H30BrNO2 — CID 176731772
5-(4-bromophenyl)-5-[4-[2-(dimethylamino)ethoxy]phenyl]-4-phenylpent-4-en-1-ol (PubChem CID 176731772) has the molecular formula C27H30BrNO2 and a molecular weight of 480.45 g/mol. Its IUPAC name is 5-(4-bromophenyl)-5-[4-[2-(dimethylamino)ethoxy]phenyl]-4-phenylpent-4-en-1-ol.
| Compound Name | 5-(4-bromophenyl)-5-[4-[2-(dimethylamino)ethoxy]phenyl]-4-phenylpent-4-en-1-ol |
|---|---|
| PubChem CID | 176731772 |
| Molecular Formula | C27H30BrNO2 |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 5-(4-bromophenyl)-5-[4-[2-(dimethylamino)ethoxy]phenyl]-4-phenylpent-4-en-1-ol |
| SMILES | CN(C)CCOc1ccc(C(=C(CCCO)c2ccccc2)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C27H30BrNO2/c1-29(2)18-20-31-25-16-12-23(13-17-25)27(22-10-14-24(28)15-11-22)26(9-6-19-30)21-7-4-3-5-8-21/h3-5,7-8,10-17,30H,6,9,18-20H2,1-2H3 |
| InChIKey | ACGXDAQUIUCBIT-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|