C33H34O6 — CID 86623314
tert-butyl (E)-3-[4-[1,1-bis(4-acetyloxyphenyl)but-1-en-2-yl]phenyl]prop-2-enoate (PubChem CID 86623314) has the molecular formula C33H34O6 and a molecular weight of 526.63 g/mol. Its IUPAC name is tert-butyl (E)-3-[4-[1,1-bis(4-acetyloxyphenyl)but-1-en-2-yl]phenyl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[4-[1,1-bis(4-acetyloxyphenyl)but-1-en-2-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 86623314 |
| Molecular Formula | C33H34O6 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | tert-butyl (E)-3-[4-[1,1-bis(4-acetyloxyphenyl)but-1-en-2-yl]phenyl]prop-2-enoate |
| SMILES | CCC(=C(c1ccc(OC(C)=O)cc1)c1ccc(OC(C)=O)cc1)c1ccc(/C=C/C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C33H34O6/c1-7-30(25-11-8-24(9-12-25)10-21-31(36)39-33(4,5)6)32(26-13-17-28(18-14-26)37-22(2)34)27-15-19-29(20-16-27)38-23(3)35/h8-21H,7H2,1-6H3/b21-10+ |
| InChIKey | BRVLCEBJJWGODM-UFFVCSGVSA-N |
| XLogP | 7.26 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|