C26H28O4S — CID 130287998
2-[4-[(Z)-1,2-diphenylpent-1-enyl]phenoxy]ethyl methanesulfonate (PubChem CID 130287998) has the molecular formula C26H28O4S and a molecular weight of 436.57 g/mol. Its IUPAC name is 2-[4-[(Z)-1,2-diphenylpent-1-enyl]phenoxy]ethyl methanesulfonate.
| Compound Name | 2-[4-[(Z)-1,2-diphenylpent-1-enyl]phenoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 130287998 |
| Molecular Formula | C26H28O4S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-[4-[(Z)-1,2-diphenylpent-1-enyl]phenoxy]ethyl methanesulfonate |
| SMILES | CCC/C(=C(\c1ccccc1)c1ccc(OCCOS(C)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H28O4S/c1-3-10-25(21-11-6-4-7-12-21)26(22-13-8-5-9-14-22)23-15-17-24(18-16-23)29-19-20-30-31(2,27)28/h4-9,11-18H,3,10,19-20H2,1-2H3/b26-25- |
| InChIKey | ZODTUUSRMNQTEQ-QPLCGJKRSA-N |
| XLogP | 5.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|