C23H28F3NO2 — CID 170189389
N-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]-N-hydroxy-4-(trifluoromethyl)benzamide (PubChem CID 170189389) has the molecular formula C23H28F3NO2 and a molecular weight of 407.48 g/mol. Its IUPAC name is N-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]-N-hydroxy-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]-N-hydroxy-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 170189389 |
| Molecular Formula | C23H28F3NO2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | N-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]-N-hydroxy-4-(trifluoromethyl)benzamide |
| SMILES | C=C[C@]1(C)CC[C@@H](C(=C)CN(O)C(=O)c2ccc(C(F)(F)F)cc2)C[C@H]1C(=C)C |
| InChI | InChI=1S/C23H28F3NO2/c1-6-22(5)12-11-18(13-20(22)15(2)3)16(4)14-27(29)21(28)17-7-9-19(10-8-17)23(24,25)26/h6-10,18,20,29H,1-2,4,11-14H2,3,5H3/t18-,20+,22-/m1/s1 |
| InChIKey | KBWYVXAQZDFYPU-KAGYGMCKSA-N |
| XLogP | 6.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|