C21H34O — CID 73189550
1-ethenyl-4-(6-methoxy-6-methylhepta-2,4-dien-2-yl)-1-methyl-2-prop-1-en-2-ylcyclohexane (PubChem CID 73189550) has the molecular formula C21H34O and a molecular weight of 302.50 g/mol. Its IUPAC name is 1-ethenyl-4-(6-methoxy-6-methylhepta-2,4-dien-2-yl)-1-methyl-2-prop-1-en-2-ylcyclohexane.
| Compound Name | 1-ethenyl-4-(6-methoxy-6-methylhepta-2,4-dien-2-yl)-1-methyl-2-prop-1-en-2-ylcyclohexane |
|---|---|
| PubChem CID | 73189550 |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | 1-ethenyl-4-(6-methoxy-6-methylhepta-2,4-dien-2-yl)-1-methyl-2-prop-1-en-2-ylcyclohexane |
| SMILES | C=CC1(C)CCC(C(C)=CC=CC(C)(C)OC)CC1C(=C)C |
| InChI | InChI=1S/C21H34O/c1-9-21(7)14-12-18(15-19(21)16(2)3)17(4)11-10-13-20(5,6)22-8/h9-11,13,18-19H,1-2,12,14-15H2,3-8H3 |
| InChIKey | NRZZJIIZNPJMNU-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|