C15H22O3 — CID 142830162
ethane;(3-methyloxetan-3-yl)methyl 2-methylbenzoate (PubChem CID 142830162) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is ethane;(3-methyloxetan-3-yl)methyl 2-methylbenzoate.
| Compound Name | ethane;(3-methyloxetan-3-yl)methyl 2-methylbenzoate |
|---|---|
| PubChem CID | 142830162 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | ethane;(3-methyloxetan-3-yl)methyl 2-methylbenzoate |
| SMILES | CC.Cc1ccccc1C(=O)OCC1(C)COC1 |
| InChI | InChI=1S/C13H16O3.C2H6/c1-10-5-3-4-6-11(10)12(14)16-9-13(2)7-15-8-13;1-2/h3-6H,7-9H2,1-2H3;1-2H3 |
| InChIKey | SOIWZMHCYKFXSI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |