C14H13F3NO6S- — CID 164777491
(1Z)-2-[(3-methyloxetan-3-yl)methoxycarbonyl]-N-(trifluoromethylsulfonyl)benzenecarboximidate (PubChem CID 164777491) has the molecular formula C14H13F3NO6S- and a molecular weight of 380.32 g/mol. Its IUPAC name is (1Z)-2-[(3-methyloxetan-3-yl)methoxycarbonyl]-N-(trifluoromethylsulfonyl)benzenecarboximidate.
| Compound Name | (1Z)-2-[(3-methyloxetan-3-yl)methoxycarbonyl]-N-(trifluoromethylsulfonyl)benzenecarboximidate |
|---|---|
| PubChem CID | 164777491 |
| Molecular Formula | C14H13F3NO6S- |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | (1Z)-2-[(3-methyloxetan-3-yl)methoxycarbonyl]-N-(trifluoromethylsulfonyl)benzenecarboximidate |
| SMILES | CC1(COC(=O)c2ccccc2/C([O-])=N/S(=O)(=O)C(F)(F)F)COC1 |
| InChI | InChI=1S/C14H14F3NO6S/c1-13(6-23-7-13)8-24-12(20)10-5-3-2-4-9(10)11(19)18-25(21,22)14(15,16)17/h2-5H,6-8H2,1H3,(H,18,19)/p-1 |
| InChIKey | LXUKGNURUKAHHD-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 105.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|