About (3-methyloxetan-3-yl)methyl 2-phenylmethoxyacetate
(3-methyloxetan-3-yl)methyl 2-phenylmethoxyacetate (PubChem CID 164728573) has the molecular formula C14H18O4
and a molecular weight of 250.29 g/mol. Its IUPAC name is (3-methyloxetan-3-yl)methyl 2-phenylmethoxyacetate.
Molecular Properties
| Compound Name | (3-methyloxetan-3-yl)methyl 2-phenylmethoxyacetate |
| PubChem CID | 164728573 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (3-methyloxetan-3-yl)methyl 2-phenylmethoxyacetate |
| SMILES | CC1(COC(=O)COCc2ccccc2)COC1 |
| InChI | InChI=1S/C14H18O4/c1-14(9-17-10-14)11-18-13(15)8-16-7-12-5-3-2-4-6-12/h2-6H,7-11H2,1H3 |
| InChIKey | GHSUTLDBXOADFY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methyloxetan-3-yl)methyl 2-phenylmethoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyloxetan-3-yl)methyl 2-phenylmethoxyacetate?
The IUPAC name of (3-methyloxetan-3-yl)methyl 2-phenylmethoxyacetate (CID 164728573) is (3-methyloxetan-3-yl)methyl 2-phenylmethoxyacetate.
What is the SMILES notation for (3-methyloxetan-3-yl)methyl 2-phenylmethoxyacetate?
The canonical SMILES for (3-methyloxetan-3-yl)methyl 2-phenylmethoxyacetate is CC1(COC(=O)COCc2ccccc2)COC1.
What is the InChIKey of (3-methyloxetan-3-yl)methyl 2-phenylmethoxyacetate?
The InChIKey is GHSUTLDBXOADFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O4/c1-14(9-17-10-14)11-18-13(15)8-16-7-12-5-3-2-4-6-12/h2-6H,7-11H2,1H3.
What are the key properties of (3-methyloxetan-3-yl)methyl 2-phenylmethoxyacetate?
(3-methyloxetan-3-yl)methyl 2-phenylmethoxyacetate has a molecular weight of 250.29 g/mol, XLogP of 1.78, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyloxetan-3-yl)methyl 2-phenylmethoxyacetate is sourced from PubChem (CID 164728573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).