C13H16O3S — CID 101226498
5-methyl-5-(phenylmethoxymethyl)-1,3-dioxane-2-thione (PubChem CID 101226498) has the molecular formula C13H16O3S and a molecular weight of 252.33 g/mol. Its IUPAC name is 5-methyl-5-(phenylmethoxymethyl)-1,3-dioxane-2-thione.
| Compound Name | 5-methyl-5-(phenylmethoxymethyl)-1,3-dioxane-2-thione |
|---|---|
| PubChem CID | 101226498 |
| Molecular Formula | C13H16O3S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 5-methyl-5-(phenylmethoxymethyl)-1,3-dioxane-2-thione |
| SMILES | CC1(COCc2ccccc2)COC(=S)OC1 |
| InChI | InChI=1S/C13H16O3S/c1-13(9-15-12(17)16-10-13)8-14-7-11-5-3-2-4-6-11/h2-6H,7-10H2,1H3 |
| InChIKey | BTJWPQFLJFELQC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|