C17H26O6 — CID 159973315
[3-(hydroxymethyl)oxetan-3-yl]methanol;[3-(phenylmethoxymethyl)oxetan-3-yl]methanol (PubChem CID 159973315) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is [3-(hydroxymethyl)oxetan-3-yl]methanol;[3-(phenylmethoxymethyl)oxetan-3-yl]methanol.
| Compound Name | [3-(hydroxymethyl)oxetan-3-yl]methanol;[3-(phenylmethoxymethyl)oxetan-3-yl]methanol |
|---|---|
| PubChem CID | 159973315 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [3-(hydroxymethyl)oxetan-3-yl]methanol;[3-(phenylmethoxymethyl)oxetan-3-yl]methanol |
| SMILES | OCC1(CO)COC1.OCC1(COCc2ccccc2)COC1 |
| InChI | InChI=1S/C12H16O3.C5H10O3/c13-7-12(9-15-10-12)8-14-6-11-4-2-1-3-5-11;6-1-5(2-7)3-8-4-5/h1-5,13H,6-10H2;6-7H,1-4H2 |
| InChIKey | OEVKETUJVQHJIP-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |